About 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate
2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate (PubChem CID 67113877) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate.
Molecular Properties
| Compound Name | 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate |
| PubChem CID | 67113877 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate |
| SMILES | CCCCCCCCC(=O)[O-].CCc1[nH]cc[n+]1C |
| InChI | InChI=1S/C9H18O2.C6H10N2/c1-2-3-4-5-6-7-8-9(10)11;1-3-6-7-4-5-8(6)2/h2-8H2,1H3,(H,10,11);4-5H,3H2,1-2H3 |
| InChIKey | ZYRJVJDMQUZZDQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate?
The IUPAC name of 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate (CID 67113877) is 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate.
What is the SMILES notation for 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate?
The canonical SMILES for 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate is CCCCCCCCC(=O)[O-].CCc1[nH]cc[n+]1C.
What is the InChIKey of 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate?
The InChIKey is ZYRJVJDMQUZZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C6H10N2/c1-2-3-4-5-6-7-8-9(10)11;1-3-6-7-4-5-8(6)2/h2-8H2,1H3,(H,10,11);4-5H,3H2,1-2H3.
What are the key properties of 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate?
2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate has a molecular weight of 268.40 g/mol, XLogP of 1.89, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methyl-1H-imidazol-3-ium;nonanoate is sourced from PubChem (CID 67113877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).