C8H16N2O3S — CID 118062745
methanesulfonate;2-methyl-3-propyl-1H-imidazol-3-ium (PubChem CID 118062745) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is methanesulfonate;2-methyl-3-propyl-1H-imidazol-3-ium.
| Compound Name | methanesulfonate;2-methyl-3-propyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 118062745 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | methanesulfonate;2-methyl-3-propyl-1H-imidazol-3-ium |
| SMILES | CCC[n+]1cc[nH]c1C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H12N2.CH4O3S/c1-3-5-9-6-4-8-7(9)2;1-5(2,3)4/h4,6H,3,5H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | QGRMHYCMNGRMAM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|