C8H13F3N2O6S2 — CID 141305498
2-methyl-3-propylimidazol-3-ium-1-sulfonic acid;trifluoromethanesulfonate (PubChem CID 141305498) has the molecular formula C8H13F3N2O6S2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-methyl-3-propylimidazol-3-ium-1-sulfonic acid;trifluoromethanesulfonate.
| Compound Name | 2-methyl-3-propylimidazol-3-ium-1-sulfonic acid;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141305498 |
| Molecular Formula | C8H13F3N2O6S2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-methyl-3-propylimidazol-3-ium-1-sulfonic acid;trifluoromethanesulfonate |
| SMILES | CCC[n+]1ccn(S(=O)(=O)O)c1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C7H12N2O3S.CHF3O3S/c1-3-4-8-5-6-9(7(8)2)13(10,11)12;2-1(3,4)8(5,6)7/h5-6H,3-4H2,1-2H3;(H,5,6,7) |
| InChIKey | NLPLBSLDPVCNQY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|