C12H13F3N2O5S2 — CID 162535159
1-(benzenesulfonyl)-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonate (PubChem CID 162535159) has the molecular formula C12H13F3N2O5S2 and a molecular weight of 386.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 1-(benzenesulfonyl)-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162535159 |
| Molecular Formula | C12H13F3N2O5S2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 1-(benzenesulfonyl)-2,3-dimethylimidazol-3-ium;trifluoromethanesulfonate |
| SMILES | Cc1n(S(=O)(=O)c2ccccc2)cc[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H13N2O2S.CHF3O3S/c1-10-12(2)8-9-13(10)16(14,15)11-6-4-3-5-7-11;2-1(3,4)8(5,6)7/h3-9H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | CMIXBEZNNFQIHJ-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|