C14H14F3NO4S — CID 11566456
1-methyl-2-phenylmethoxypyridin-1-ium;trifluoromethanesulfonate (PubChem CID 11566456) has the molecular formula C14H14F3NO4S and a molecular weight of 349.33 g/mol. Its IUPAC name is 1-methyl-2-phenylmethoxypyridin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-methyl-2-phenylmethoxypyridin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11566456 |
| Molecular Formula | C14H14F3NO4S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1-methyl-2-phenylmethoxypyridin-1-ium;trifluoromethanesulfonate |
| SMILES | C[n+]1ccccc1OCc1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H14NO.CHF3O3S/c1-14-10-6-5-9-13(14)15-11-12-7-3-2-4-8-12;2-1(3,4)8(5,6)7/h2-10H,11H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | DUXHYQYOPHEFGC-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|