C10H8F5O4S- — CID 151822916
1,1,3,3,3-pentafluoro-2-phenylmethoxypropane-1-sulfonate (PubChem CID 151822916) has the molecular formula C10H8F5O4S- and a molecular weight of 319.23 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-phenylmethoxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-phenylmethoxypropane-1-sulfonate |
|---|---|
| PubChem CID | 151822916 |
| Molecular Formula | C10H8F5O4S- |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-phenylmethoxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F5O4S/c11-9(12,13)8(10(14,15)20(16,17)18)19-6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,16,17,18)/p-1 |
| InChIKey | SCZUSPGPWQWMET-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|