C17H23F5O5S2 — CID 158104341
2-(2,2-dimethylbutanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;dimethyl(phenyl)sulfanium (PubChem CID 158104341) has the molecular formula C17H23F5O5S2 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;dimethyl(phenyl)sulfanium.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;dimethyl(phenyl)sulfanium |
|---|---|
| PubChem CID | 158104341 |
| Molecular Formula | C17H23F5O5S2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;dimethyl(phenyl)sulfanium |
| SMILES | CCC(C)(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].C[S+](C)c1ccccc1 |
| InChI | InChI=1S/C9H13F5O5S.C8H11S/c1-4-7(2,3)6(15)19-5(8(10,11)12)9(13,14)20(16,17)18;1-9(2)8-6-4-3-5-7-8/h5H,4H2,1-3H3,(H,16,17,18);3-7H,1-2H3/q;+1/p-1 |
| InChIKey | FPQOWOLGVUBJJQ-UHFFFAOYSA-M |
| XLogP | 3.96 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|