About 1-methylpyridin-1-ium;phenylmethanesulfonate
1-methylpyridin-1-ium;phenylmethanesulfonate (PubChem CID 141072222) has the molecular formula C13H15NO3S
and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-methylpyridin-1-ium;phenylmethanesulfonate.
Molecular Properties
| Compound Name | 1-methylpyridin-1-ium;phenylmethanesulfonate |
| PubChem CID | 141072222 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-methylpyridin-1-ium;phenylmethanesulfonate |
| SMILES | C[n+]1ccccc1.O=S(=O)([O-])Cc1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C6H8N/c8-11(9,10)6-7-4-2-1-3-5-7;1-7-5-3-2-4-6-7/h1-5H,6H2,(H,8,9,10);2-6H,1H3/q;+1/p-1 |
| InChIKey | KERDNLYARHNMMH-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyridin-1-ium;phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyridin-1-ium;phenylmethanesulfonate?
The IUPAC name of 1-methylpyridin-1-ium;phenylmethanesulfonate (CID 141072222) is 1-methylpyridin-1-ium;phenylmethanesulfonate.
What is the SMILES notation for 1-methylpyridin-1-ium;phenylmethanesulfonate?
The canonical SMILES for 1-methylpyridin-1-ium;phenylmethanesulfonate is C[n+]1ccccc1.O=S(=O)([O-])Cc1ccccc1.
What is the InChIKey of 1-methylpyridin-1-ium;phenylmethanesulfonate?
The InChIKey is KERDNLYARHNMMH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.C6H8N/c8-11(9,10)6-7-4-2-1-3-5-7;1-7-5-3-2-4-6-7/h1-5H,6H2,(H,8,9,10);2-6H,1H3/q;+1/p-1.
What are the key properties of 1-methylpyridin-1-ium;phenylmethanesulfonate?
1-methylpyridin-1-ium;phenylmethanesulfonate has a molecular weight of 265.33 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyridin-1-ium;phenylmethanesulfonate is sourced from PubChem (CID 141072222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).