About phenylmethanesulfonate;1H-pyrrol-1-ium
phenylmethanesulfonate;1H-pyrrol-1-ium (PubChem CID 141216947) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is phenylmethanesulfonate;1H-pyrrol-1-ium.
Molecular Properties
| Compound Name | phenylmethanesulfonate;1H-pyrrol-1-ium |
| PubChem CID | 141216947 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | phenylmethanesulfonate;1H-pyrrol-1-ium |
| SMILES | C1=C[NH2+]C=C1.O=S(=O)([O-])Cc1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C4H5N/c8-11(9,10)6-7-4-2-1-3-5-7;1-2-4-5-3-1/h1-5H,6H2,(H,8,9,10);1-5H |
| InChIKey | PIPRWHBDRCRQJM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanesulfonate;1H-pyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanesulfonate;1H-pyrrol-1-ium?
The IUPAC name of phenylmethanesulfonate;1H-pyrrol-1-ium (CID 141216947) is phenylmethanesulfonate;1H-pyrrol-1-ium.
What is the SMILES notation for phenylmethanesulfonate;1H-pyrrol-1-ium?
The canonical SMILES for phenylmethanesulfonate;1H-pyrrol-1-ium is C1=C[NH2+]C=C1.O=S(=O)([O-])Cc1ccccc1.
What is the InChIKey of phenylmethanesulfonate;1H-pyrrol-1-ium?
The InChIKey is PIPRWHBDRCRQJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C4H5N/c8-11(9,10)6-7-4-2-1-3-5-7;1-2-4-5-3-1/h1-5H,6H2,(H,8,9,10);1-5H.
What are the key properties of phenylmethanesulfonate;1H-pyrrol-1-ium?
phenylmethanesulfonate;1H-pyrrol-1-ium has a molecular weight of 239.30 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanesulfonate;1H-pyrrol-1-ium is sourced from PubChem (CID 141216947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).