C13H21NO3S — CID 139909986
1-ethylpyrrolidin-1-ium;phenylmethanesulfonate (PubChem CID 139909986) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-ethylpyrrolidin-1-ium;phenylmethanesulfonate.
| Compound Name | 1-ethylpyrrolidin-1-ium;phenylmethanesulfonate |
|---|---|
| PubChem CID | 139909986 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-ethylpyrrolidin-1-ium;phenylmethanesulfonate |
| SMILES | CC[NH+]1CCCC1.O=S(=O)([O-])Cc1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C6H13N/c8-11(9,10)6-7-4-2-1-3-5-7;1-2-7-5-3-4-6-7/h1-5H,6H2,(H,8,9,10);2-6H2,1H3 |
| InChIKey | LMRAVXIGFPAAIT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|