C23H24F3NO4S — CID 71605549
1-methyl-2-[(4-methylphenoxy)methyl]-4-[(4-methylphenyl)methyl]pyridin-1-ium;trifluoromethanesulfonate (PubChem CID 71605549) has the molecular formula C23H24F3NO4S and a molecular weight of 467.51 g/mol. Its IUPAC name is 1-methyl-2-[(4-methylphenoxy)methyl]-4-[(4-methylphenyl)methyl]pyridin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-methyl-2-[(4-methylphenoxy)methyl]-4-[(4-methylphenyl)methyl]pyridin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71605549 |
| Molecular Formula | C23H24F3NO4S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-methyl-2-[(4-methylphenoxy)methyl]-4-[(4-methylphenyl)methyl]pyridin-1-ium;trifluoromethanesulfonate |
| SMILES | Cc1ccc(Cc2cc[n+](C)c(COc3ccc(C)cc3)c2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H24NO.CHF3O3S/c1-17-4-8-19(9-5-17)14-20-12-13-23(3)21(15-20)16-24-22-10-6-18(2)7-11-22;2-1(3,4)8(5,6)7/h4-13,15H,14,16H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | HJABZUPXALWZRH-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|