C24H29NO4S — CID 15945632
2-[(4-tert-butylphenoxy)methyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate (PubChem CID 15945632) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate.
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15945632 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
| SMILES | C[n+]1ccccc1COc1ccc(C(C)(C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C17H22NO.C7H8O3S/c1-17(2,3)14-8-10-16(11-9-14)19-13-15-7-5-6-12-18(15)4;1-6-2-4-7(5-3-6)11(8,9)10/h5-12H,13H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | OIEVBIQYFAWADY-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|