C11H12F3NO3S2 — CID 155045904
3-propyl-1,3-benzothiazol-3-ium;trifluoromethanesulfonate (PubChem CID 155045904) has the molecular formula C11H12F3NO3S2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 3-propyl-1,3-benzothiazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 3-propyl-1,3-benzothiazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155045904 |
| Molecular Formula | C11H12F3NO3S2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3-propyl-1,3-benzothiazol-3-ium;trifluoromethanesulfonate |
| SMILES | CCC[n+]1csc2ccccc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H12NS.CHF3O3S/c1-2-7-11-8-12-10-6-4-3-5-9(10)11;2-1(3,4)8(5,6)7/h3-6,8H,2,7H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | PGIWOVOLVZUYFA-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|