C16H24NS+ — CID 72734630
3-nonyl-1,3-benzothiazol-3-ium (PubChem CID 72734630) has the molecular formula C16H24NS+ and a molecular weight of 262.44 g/mol. Its IUPAC name is 3-nonyl-1,3-benzothiazol-3-ium.
| Compound Name | 3-nonyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 72734630 |
| Molecular Formula | C16H24NS+ |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 3-nonyl-1,3-benzothiazol-3-ium |
| SMILES | CCCCCCCCC[n+]1csc2ccccc21 |
| InChI | InChI=1S/C16H24NS/c1-2-3-4-5-6-7-10-13-17-14-18-16-12-9-8-11-15(16)17/h8-9,11-12,14H,2-7,10,13H2,1H3/q+1 |
| InChIKey | PHHSEDHGJVLHMI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|