C14H20INS — CID 67728980
3-heptyl-1,3-benzothiazol-3-ium iodide (PubChem CID 67728980) has the molecular formula C14H20INS and a molecular weight of 361.29 g/mol. Its IUPAC name is 3-heptyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 3-heptyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 67728980 |
| Molecular Formula | C14H20INS |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-heptyl-1,3-benzothiazol-3-ium iodide |
| SMILES | CCCCCCC[n+]1csc2ccccc21.[I-] |
| InChI | InChI=1S/C14H20NS.HI/c1-2-3-4-5-8-11-15-12-16-14-10-7-6-9-13(14)15;/h6-7,9-10,12H,2-5,8,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | DRDNXEIOXKKJRA-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|