About 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide
3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide (PubChem CID 6453914) has the molecular formula C11H14INS
and a molecular weight of 319.21 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide.
Molecular Properties
| Compound Name | 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide |
| PubChem CID | 6453914 |
| Molecular Formula | C11H14INS |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide |
| SMILES | CC(C)C[n+]1csc2ccccc21.[I-] |
| InChI | InChI=1S/C11H14NS.HI/c1-9(2)7-12-8-13-11-6-4-3-5-10(11)12;/h3-6,8-9H,7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZHSORAHGHZOKDH-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide?
The IUPAC name of 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide (CID 6453914) is 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide.
What is the SMILES notation for 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide?
The canonical SMILES for 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide is CC(C)C[n+]1csc2ccccc21.[I-].
What is the InChIKey of 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide?
The InChIKey is ZHSORAHGHZOKDH-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14NS.HI/c1-9(2)7-12-8-13-11-6-4-3-5-10(11)12;/h3-6,8-9H,7H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide?
3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide has a molecular weight of 319.21 g/mol, XLogP of -0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropyl)-1,3-benzothiazol-3-ium iodide is sourced from PubChem (CID 6453914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).