C12H13N3S+2 — CID 177422665
3-[(3-methylimidazol-3-ium-1-yl)methyl]-1,3-benzothiazol-3-ium (PubChem CID 177422665) has the molecular formula C12H13N3S+2 and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-[(3-methylimidazol-3-ium-1-yl)methyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-[(3-methylimidazol-3-ium-1-yl)methyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 177422665 |
| Molecular Formula | C12H13N3S+2 |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-[(3-methylimidazol-3-ium-1-yl)methyl]-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1ccn(C[n+]2csc3ccccc32)c1 |
| InChI | InChI=1S/C12H13N3S/c1-13-6-7-14(8-13)9-15-10-16-12-5-3-2-4-11(12)15/h2-8,10H,9H2,1H3/q+2 |
| InChIKey | BQHXHRYQVPZFQD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|