About 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride
1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride (PubChem CID 25070370) has the molecular formula C11H13AuClN2+
and a molecular weight of 405.66 g/mol. Its IUPAC name is 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride.
Molecular Properties
| Compound Name | 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride |
| PubChem CID | 25070370 |
| Molecular Formula | C11H13AuClN2+ |
| Molecular Weight | 405.66 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride |
| SMILES | C[n+]1ccn(Cc2ccccc2)c1.[Au+].[Cl-] |
| InChI | InChI=1S/C11H13N2.Au.ClH/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;;/h2-8,10H,9H2,1H3;;1H/q2*+1;/p-1 |
| InChIKey | DJBAHDSQJCPSLS-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.66 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride?
The IUPAC name of 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride (CID 25070370) is 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride.
What is the SMILES notation for 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride?
The canonical SMILES for 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride is C[n+]1ccn(Cc2ccccc2)c1.[Au+].[Cl-].
What is the InChIKey of 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride?
The InChIKey is DJBAHDSQJCPSLS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13N2.Au.ClH/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;;/h2-8,10H,9H2,1H3;;1H/q2*+1;/p-1.
What are the key properties of 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride?
1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride has a molecular weight of 405.66 g/mol, XLogP of -1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methylimidazol-3-ium;gold(1+);chloride is sourced from PubChem (CID 25070370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).