C11H13F6N2P — CID 11461285
1-benzyl-3-methylimidazol-3-ium hexafluorophosphate (PubChem CID 11461285) has the molecular formula C11H13F6N2P and a molecular weight of 318.20 g/mol. Its IUPAC name is 1-benzyl-3-methylimidazol-3-ium hexafluorophosphate.
| Compound Name | 1-benzyl-3-methylimidazol-3-ium hexafluorophosphate |
|---|---|
| PubChem CID | 11461285 |
| Molecular Formula | C11H13F6N2P |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-benzyl-3-methylimidazol-3-ium hexafluorophosphate |
| SMILES | C[n+]1ccn(Cc2ccccc2)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C11H13N2.F6P/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;1-7(2,3,4,5)6/h2-8,10H,9H2,1H3;/q+1;-1 |
| InChIKey | VVCQOUQQPZPIKL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|