C9H9BrNS+ — CID 10406821
3-(2-bromoethyl)-1,3-benzothiazol-3-ium (PubChem CID 10406821) has the molecular formula C9H9BrNS+ and a molecular weight of 243.15 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1,3-benzothiazol-3-ium.
| Compound Name | 3-(2-bromoethyl)-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 10406821 |
| Molecular Formula | C9H9BrNS+ |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 3-(2-bromoethyl)-1,3-benzothiazol-3-ium |
| SMILES | BrCC[n+]1csc2ccccc21 |
| InChI | InChI=1S/C9H9BrNS/c10-5-6-11-7-12-9-4-2-1-3-8(9)11/h1-4,7H,5-6H2/q+1 |
| InChIKey | NCRDHYKWMOEWFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|