C15H13N2OS+ — CID 5478158
(NZ)-N-[2-(1,3-benzothiazol-3-ium-3-yl)-1-phenylethylidene]hydroxylamine (PubChem CID 5478158) has the molecular formula C15H13N2OS+ and a molecular weight of 269.35 g/mol. Its IUPAC name is (NZ)-N-[2-(1,3-benzothiazol-3-ium-3-yl)-1-phenylethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-(1,3-benzothiazol-3-ium-3-yl)-1-phenylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 5478158 |
| Molecular Formula | C15H13N2OS+ |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (NZ)-N-[2-(1,3-benzothiazol-3-ium-3-yl)-1-phenylethylidene]hydroxylamine |
| SMILES | O/N=C(\C[n+]1csc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C15H12N2OS/c18-16-13(12-6-2-1-3-7-12)10-17-11-19-15-9-5-4-8-14(15)17/h1-9,11H,10H2/p+1/b16-13+ |
| InChIKey | DMLCEPIVJGIKCI-DTQAZKPQSA-O |
| XLogP | 3.07 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|