C16H11N2OS+ — CID 139744211
3-phenacyl-1,3-benzothiazol-3-ium-4-carbonitrile (PubChem CID 139744211) has the molecular formula C16H11N2OS+ and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-phenacyl-1,3-benzothiazol-3-ium-4-carbonitrile.
| Compound Name | 3-phenacyl-1,3-benzothiazol-3-ium-4-carbonitrile |
|---|---|
| PubChem CID | 139744211 |
| Molecular Formula | C16H11N2OS+ |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-phenacyl-1,3-benzothiazol-3-ium-4-carbonitrile |
| SMILES | N#Cc1cccc2sc[n+](CC(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C16H11N2OS/c17-9-13-7-4-8-15-16(13)18(11-20-15)10-14(19)12-5-2-1-3-6-12/h1-8,11H,10H2/q+1 |
| InChIKey | FPKRFHJQKHUKGA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|