C13H14BrNO2S — CID 87925347
2-[2-(2-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]-1-phenylethanone bromide (PubChem CID 87925347) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]-1-phenylethanone bromide.
| Compound Name | 2-[2-(2-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]-1-phenylethanone bromide |
|---|---|
| PubChem CID | 87925347 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-[2-(2-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]-1-phenylethanone bromide |
| SMILES | O=C(C[n+]1ccsc1CCO)c1ccccc1.[Br-] |
| InChI | InChI=1S/C13H14NO2S.BrH/c15-8-6-13-14(7-9-17-13)10-12(16)11-4-2-1-3-5-11;/h1-5,7,9,15H,6,8,10H2;1H/q+1;/p-1 |
| InChIKey | PKSQJGKXOUJIBG-UHFFFAOYSA-M |
| XLogP | -1.54 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|