C12H12NOS+ — CID 22220741
2-(2-methyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone (PubChem CID 22220741) has the molecular formula C12H12NOS+ and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone.
| Compound Name | 2-(2-methyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 22220741 |
| Molecular Formula | C12H12NOS+ |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone |
| SMILES | Cc1scc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12NOS/c1-10-13(7-8-15-10)9-12(14)11-5-3-2-4-6-11/h2-8H,9H2,1H3/q+1 |
| InChIKey | IENSUTSPBXCKOJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|