C11H10BrFN2OS — CID 172746376
2-(2-amino-1,3-thiazol-3-ium-3-yl)-1-(4-fluorophenyl)ethanone bromide (PubChem CID 172746376) has the molecular formula C11H10BrFN2OS and a molecular weight of 317.18 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-3-ium-3-yl)-1-(4-fluorophenyl)ethanone bromide.
| Compound Name | 2-(2-amino-1,3-thiazol-3-ium-3-yl)-1-(4-fluorophenyl)ethanone bromide |
|---|---|
| PubChem CID | 172746376 |
| Molecular Formula | C11H10BrFN2OS |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-3-ium-3-yl)-1-(4-fluorophenyl)ethanone bromide |
| SMILES | Nc1scc[n+]1CC(=O)c1ccc(F)cc1.[Br-] |
| InChI | InChI=1S/C11H9FN2OS.BrH/c12-9-3-1-8(2-4-9)10(15)7-14-5-6-16-11(14)13;/h1-6,13H,7H2;1H |
| InChIKey | JTWVMLYUUYVAMZ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|