C11H14NO3S2+ — CID 5172034
4-(1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonic acid (PubChem CID 5172034) has the molecular formula C11H14NO3S2+ and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonic acid.
| Compound Name | 4-(1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 5172034 |
| Molecular Formula | C11H14NO3S2+ |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-(1,3-benzothiazol-3-ium-3-yl)butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCC[n+]1csc2ccccc21 |
| InChI | InChI=1S/C11H13NO3S2/c13-17(14,15)8-4-3-7-12-9-16-11-6-2-1-5-10(11)12/h1-2,5-6,9H,3-4,7-8H2/p+1 |
| InChIKey | AJVSZFZZNQFYQS-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|