C12H15N2OS+ — CID 2842813
2-(1,3-benzothiazol-3-ium-3-yl)-N-propylacetamide (PubChem CID 2842813) has the molecular formula C12H15N2OS+ and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-3-ium-3-yl)-N-propylacetamide.
| Compound Name | 2-(1,3-benzothiazol-3-ium-3-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 2842813 |
| Molecular Formula | C12H15N2OS+ |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-(1,3-benzothiazol-3-ium-3-yl)-N-propylacetamide |
| SMILES | CCCNC(=O)C[n+]1csc2ccccc21 |
| InChI | InChI=1S/C12H14N2OS/c1-2-7-13-12(15)8-14-9-16-11-6-4-3-5-10(11)14/h3-6,9H,2,7-8H2,1H3/p+1 |
| InChIKey | LRXAYCVDIXVSAF-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|