C16H14NS+ — CID 118204465
3-[(E)-3-phenylprop-2-enyl]-1,3-benzothiazol-3-ium (PubChem CID 118204465) has the molecular formula C16H14NS+ and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-[(E)-3-phenylprop-2-enyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-[(E)-3-phenylprop-2-enyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 118204465 |
| Molecular Formula | C16H14NS+ |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-[(E)-3-phenylprop-2-enyl]-1,3-benzothiazol-3-ium |
| SMILES | C(=C/c1ccccc1)\C[n+]1csc2ccccc21 |
| InChI | InChI=1S/C16H14NS/c1-2-7-14(8-3-1)9-6-12-17-13-18-16-11-5-4-10-15(16)17/h1-11,13H,12H2/q+1/b9-6+ |
| InChIKey | MWHRVYCEZLTLCO-RMKNXTFCSA-N |
| XLogP | 3.90 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|