C15H15BrN2O — CID 172959662
(NE)-N-[[1-(3-phenylprop-2-enyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide (PubChem CID 172959662) has the molecular formula C15H15BrN2O and a molecular weight of 319.20 g/mol. Its IUPAC name is (NE)-N-[[1-(3-phenylprop-2-enyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide.
| Compound Name | (NE)-N-[[1-(3-phenylprop-2-enyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide |
|---|---|
| PubChem CID | 172959662 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (NE)-N-[[1-(3-phenylprop-2-enyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide |
| SMILES | O/N=C/c1cc[n+](CC=Cc2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C15H14N2O.BrH/c18-16-13-15-8-11-17(12-9-15)10-4-7-14-5-2-1-3-6-14;/h1-9,11-13H,10H2;1H |
| InChIKey | LBONXIOIBJWFQS-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|