About hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile
hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile (PubChem CID 22005428) has the molecular formula C15H13F6N2Sb
and a molecular weight of 457.03 g/mol. Its IUPAC name is hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile |
| PubChem CID | 22005428 |
| Molecular Formula | C15H13F6N2Sb |
| Molecular Weight | 457.03 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile |
| SMILES | F[Sb-](F)(F)(F)(F)F.N#Cc1cccc[n+]1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H13N2.6FH.Sb/c16-13-15-10-4-5-11-17(15)12-6-9-14-7-2-1-3-8-14;;;;;;;/h1-11H,12H2;6*1H;/q+1;;;;;;;+5/p-6/b9-6+;;;;;;; |
| InChIKey | YBBBIBPYBJFBGD-ZDEZGLNTSA-H |
| XLogP | 4.70 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.03 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile?
The IUPAC name of hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile (CID 22005428) is hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile.
What is the SMILES notation for hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile?
The canonical SMILES for hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile is F[Sb-](F)(F)(F)(F)F.N#Cc1cccc[n+]1C/C=C/c1ccccc1.
What is the InChIKey of hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile?
The InChIKey is YBBBIBPYBJFBGD-ZDEZGLNTSA-H. The full InChI is InChI=1S/C15H13N2.6FH.Sb/c16-13-15-10-4-5-11-17(15)12-6-9-14-7-2-1-3-8-14;;;;;;;/h1-11H,12H2;6*1H;/q+1;;;;;;;+5/p-6/b9-6+;;;;;;;.
What are the key properties of hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile?
hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile has a molecular weight of 457.03 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);1-[(E)-3-phenylprop-2-enyl]pyridin-1-ium-2-carbonitrile is sourced from PubChem (CID 22005428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).