C8H10INS+2 — CID 172825458
iodanium 3-methyl-1,3-benzothiazol-3-ium (PubChem CID 172825458) has the molecular formula C8H10INS+2 and a molecular weight of 279.15 g/mol. Its IUPAC name is iodanium 3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | iodanium 3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 172825458 |
| Molecular Formula | C8H10INS+2 |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | iodanium 3-methyl-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1csc2ccccc21.[IH2+] |
| InChI | InChI=1S/C8H8NS.H2I/c1-9-6-10-8-5-3-2-4-7(8)9;/h2-6H,1H3;1H2/q2*+1 |
| InChIKey | XACZFLMZCXZBGM-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|