C14H12NO3S2+ — CID 87701684
1,3-benzothiazol-3-ium-3-yl 4-methylbenzenesulfonate (PubChem CID 87701684) has the molecular formula C14H12NO3S2+ and a molecular weight of 306.39 g/mol. Its IUPAC name is 1,3-benzothiazol-3-ium-3-yl 4-methylbenzenesulfonate.
| Compound Name | 1,3-benzothiazol-3-ium-3-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87701684 |
| Molecular Formula | C14H12NO3S2+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1,3-benzothiazol-3-ium-3-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[n+]2csc3ccccc32)cc1 |
| InChI | InChI=1S/C14H12NO3S2/c1-11-6-8-12(9-7-11)20(16,17)18-15-10-19-14-5-3-2-4-13(14)15/h2-10H,1H3/q+1 |
| InChIKey | ARQIEDBUPUJYNO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|