About pyridin-1-ium-1-yl 4-methylbenzenesulfonate
pyridin-1-ium-1-yl 4-methylbenzenesulfonate (PubChem CID 14967159) has the molecular formula C12H12NO3S+
and a molecular weight of 250.30 g/mol. Its IUPAC name is pyridin-1-ium-1-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | pyridin-1-ium-1-yl 4-methylbenzenesulfonate |
| PubChem CID | 14967159 |
| Molecular Formula | C12H12NO3S+ |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | pyridin-1-ium-1-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C12H12NO3S/c1-11-5-7-12(8-6-11)17(14,15)16-13-9-3-2-4-10-13/h2-10H,1H3/q+1 |
| InChIKey | MZWJATQUOCNEPN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-yl 4-methylbenzenesulfonate?
The IUPAC name of pyridin-1-ium-1-yl 4-methylbenzenesulfonate (CID 14967159) is pyridin-1-ium-1-yl 4-methylbenzenesulfonate.
What is the SMILES notation for pyridin-1-ium-1-yl 4-methylbenzenesulfonate?
The canonical SMILES for pyridin-1-ium-1-yl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O[n+]2ccccc2)cc1.
What is the InChIKey of pyridin-1-ium-1-yl 4-methylbenzenesulfonate?
The InChIKey is MZWJATQUOCNEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NO3S/c1-11-5-7-12(8-6-11)17(14,15)16-13-9-3-2-4-10-13/h2-10H,1H3/q+1.
What are the key properties of pyridin-1-ium-1-yl 4-methylbenzenesulfonate?
pyridin-1-ium-1-yl 4-methylbenzenesulfonate has a molecular weight of 250.30 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 14967159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).