C23H25N2O2S+ — CID 87272277
7-anilino-3-(1,3-benzothiazol-3-ium-3-ylmethyl)-2-ethylhepta-4,6-dienoic acid (PubChem CID 87272277) has the molecular formula C23H25N2O2S+ and a molecular weight of 393.53 g/mol. Its IUPAC name is 7-anilino-3-(1,3-benzothiazol-3-ium-3-ylmethyl)-2-ethylhepta-4,6-dienoic acid.
| Compound Name | 7-anilino-3-(1,3-benzothiazol-3-ium-3-ylmethyl)-2-ethylhepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 87272277 |
| Molecular Formula | C23H25N2O2S+ |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 7-anilino-3-(1,3-benzothiazol-3-ium-3-ylmethyl)-2-ethylhepta-4,6-dienoic acid |
| SMILES | CCC(C(=O)O)C(C=CC=CNc1ccccc1)C[n+]1csc2ccccc21 |
| InChI | InChI=1S/C23H24N2O2S/c1-2-20(23(26)27)18(10-8-9-15-24-19-11-4-3-5-12-19)16-25-17-28-22-14-7-6-13-21(22)25/h3-15,17-18,20,24H,2,16H2,1H3/p+1 |
| InChIKey | MOIDRFFIXGZCFN-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|