C22H39F3N2O3S — CID 156755258
1-ethenyl-3-hexadecylimidazol-3-ium;trifluoromethanesulfonate (PubChem CID 156755258) has the molecular formula C22H39F3N2O3S and a molecular weight of 468.63 g/mol. Its IUPAC name is 1-ethenyl-3-hexadecylimidazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 1-ethenyl-3-hexadecylimidazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156755258 |
| Molecular Formula | C22H39F3N2O3S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-ethenyl-3-hexadecylimidazol-3-ium;trifluoromethanesulfonate |
| SMILES | C=Cn1cc[n+](CCCCCCCCCCCCCCCC)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H39N2.CHF3O3S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20-19-22(4-2)21-23;2-1(3,4)8(5,6)7/h4,19-21H,2-3,5-18H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GBSBBSMUPVFHRU-UHFFFAOYSA-M |
| XLogP | 6.41 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|