C15H22F12N4P2 — CID 170460034
1-ethenyl-3-[5-(3-ethenylimidazol-1-ium-1-yl)pentyl]imidazol-3-ium dihexafluorophosphate (PubChem CID 170460034) has the molecular formula C15H22F12N4P2 and a molecular weight of 548.29 g/mol. Its IUPAC name is 1-ethenyl-3-[5-(3-ethenylimidazol-1-ium-1-yl)pentyl]imidazol-3-ium dihexafluorophosphate.
| Compound Name | 1-ethenyl-3-[5-(3-ethenylimidazol-1-ium-1-yl)pentyl]imidazol-3-ium dihexafluorophosphate |
|---|---|
| PubChem CID | 170460034 |
| Molecular Formula | C15H22F12N4P2 |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 1-ethenyl-3-[5-(3-ethenylimidazol-1-ium-1-yl)pentyl]imidazol-3-ium dihexafluorophosphate |
| SMILES | C=Cn1cc[n+](CCCCC[n+]2ccn(C=C)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C15H22N4.2F6P/c1-3-16-10-12-18(14-16)8-6-5-7-9-19-13-11-17(4-2)15-19;2*1-7(2,3,4,5)6/h3-4,10-15H,1-2,5-9H2;;/q+2;2*-1 |
| InChIKey | UOZCXRNRLIUXPH-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|