C16H23N3O3S — CID 160790324
anilinomethanesulfonate;1-butyl-3-ethenylimidazol-1-ium (PubChem CID 160790324) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is anilinomethanesulfonate;1-butyl-3-ethenylimidazol-1-ium.
| Compound Name | anilinomethanesulfonate;1-butyl-3-ethenylimidazol-1-ium |
|---|---|
| PubChem CID | 160790324 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | anilinomethanesulfonate;1-butyl-3-ethenylimidazol-1-ium |
| SMILES | C=Cn1cc[n+](CCCC)c1.O=S(=O)([O-])CNc1ccccc1 |
| InChI | InChI=1S/C9H15N2.C7H9NO3S/c1-3-5-6-11-8-7-10(4-2)9-11;9-12(10,11)6-8-7-4-2-1-3-5-7/h4,7-9H,2-3,5-6H2,1H3;1-5,8H,6H2,(H,9,10,11)/q+1;/p-1 |
| InChIKey | SBTBPSOSLFGGAI-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|