C15H16F13N2+ — CID 89464488
2-butyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1H-imidazol-3-ium (PubChem CID 89464488) has the molecular formula C15H16F13N2+ and a molecular weight of 471.28 g/mol. Its IUPAC name is 2-butyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1H-imidazol-3-ium.
| Compound Name | 2-butyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 89464488 |
| Molecular Formula | C15H16F13N2+ |
| Molecular Weight | 471.28 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 2-butyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1H-imidazol-3-ium |
| SMILES | CCCCc1[nH]cc[n+]1CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F13N2/c1-2-3-4-9-29-6-8-30(9)7-5-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h6,8H,2-5,7H2,1H3/p+1 |
| InChIKey | YSAPERATUWNTKW-UHFFFAOYSA-O |
| XLogP | 5.77 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.28 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|