C16H31N2+ — CID 164896489
3-decyl-2,4,5-trimethyl-1H-imidazol-3-ium (PubChem CID 164896489) has the molecular formula C16H31N2+ and a molecular weight of 251.44 g/mol. Its IUPAC name is 3-decyl-2,4,5-trimethyl-1H-imidazol-3-ium.
| Compound Name | 3-decyl-2,4,5-trimethyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 164896489 |
| Molecular Formula | C16H31N2+ |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.25 |
| IUPAC Name | 3-decyl-2,4,5-trimethyl-1H-imidazol-3-ium |
| SMILES | CCCCCCCCCC[n+]1c(C)[nH]c(C)c1C |
| InChI | InChI=1S/C16H30N2/c1-5-6-7-8-9-10-11-12-13-18-15(3)14(2)17-16(18)4/h5-13H2,1-4H3/p+1 |
| InChIKey | LDXKVAJZTFTBKD-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|