C14H23N2PS4+2 — CID 132942760
bis(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 132942760) has the molecular formula C14H23N2PS4+2 and a molecular weight of 378.59 g/mol. Its IUPAC name is bis(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | bis(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 132942760 |
| Molecular Formula | C14H23N2PS4+2 |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | bis(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CC[n+]1c(P(=S)(S)c2sc(C)c(C)[n+]2CC)sc(C)c1C |
| InChI | InChI=1S/C14H22N2PS4/c1-7-15-9(3)11(5)20-13(15)17(18,19)14-16(8-2)10(4)12(6)21-14/h7-8H2,1-6H3/q+1/p+1 |
| InChIKey | PQANMSOZXHNGKV-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 7.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|