C23H25N4S+ — CID 68837531
(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene (PubChem CID 68837531) has the molecular formula C23H25N4S+ and a molecular weight of 389.55 g/mol. Its IUPAC name is (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene.
| Compound Name | (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene |
|---|---|
| PubChem CID | 68837531 |
| Molecular Formula | C23H25N4S+ |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene |
| SMILES | CCn1c(-c2ccccc2)c(/N=N/c2sc(C)c(C)[n+]2CC)c2ccccc21 |
| InChI | InChI=1S/C23H25N4S/c1-5-26-16(3)17(4)28-23(26)25-24-21-19-14-10-11-15-20(19)27(6-2)22(21)18-12-8-7-9-13-18/h7-15H,5-6H2,1-4H3/q+1 |
| InChIKey | BIUQSBYZTPUBDP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|