C28H28ClN5S — CID 68832275
2-[(1,2-diphenylindol-3-yl)diazenyl]-N,N-diethyl-3-methyl-1,3-thiazol-3-ium-5-amine chloride (PubChem CID 68832275) has the molecular formula C28H28ClN5S and a molecular weight of 502.09 g/mol. Its IUPAC name is 2-[(1,2-diphenylindol-3-yl)diazenyl]-N,N-diethyl-3-methyl-1,3-thiazol-3-ium-5-amine chloride.
| Compound Name | 2-[(1,2-diphenylindol-3-yl)diazenyl]-N,N-diethyl-3-methyl-1,3-thiazol-3-ium-5-amine chloride |
|---|---|
| PubChem CID | 68832275 |
| Molecular Formula | C28H28ClN5S |
| Molecular Weight | 502.09 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-[(1,2-diphenylindol-3-yl)diazenyl]-N,N-diethyl-3-methyl-1,3-thiazol-3-ium-5-amine chloride |
| SMILES | CCN(CC)c1c[n+](C)c(/N=N/c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)s1.[Cl-] |
| InChI | InChI=1S/C28H28N5S.ClH/c1-4-32(5-2)25-20-31(3)28(34-25)30-29-26-23-18-12-13-19-24(23)33(22-16-10-7-11-17-22)27(26)21-14-8-6-9-15-21;/h6-20H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | TVKNEFGBCRPYHG-UHFFFAOYSA-M |
| XLogP | 4.45 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|