C23H26BrN5S — CID 68835624
N,N-diethyl-3-methyl-2-[(1-methyl-2-phenylindol-3-yl)diazenyl]-1,3-thiazol-3-ium-5-amine bromide (PubChem CID 68835624) has the molecular formula C23H26BrN5S and a molecular weight of 484.47 g/mol. Its IUPAC name is N,N-diethyl-3-methyl-2-[(1-methyl-2-phenylindol-3-yl)diazenyl]-1,3-thiazol-3-ium-5-amine bromide.
| Compound Name | N,N-diethyl-3-methyl-2-[(1-methyl-2-phenylindol-3-yl)diazenyl]-1,3-thiazol-3-ium-5-amine bromide |
|---|---|
| PubChem CID | 68835624 |
| Molecular Formula | C23H26BrN5S |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N,N-diethyl-3-methyl-2-[(1-methyl-2-phenylindol-3-yl)diazenyl]-1,3-thiazol-3-ium-5-amine bromide |
| SMILES | CCN(CC)c1c[n+](C)c(/N=N/c2c(-c3ccccc3)n(C)c3ccccc23)s1.[Br-] |
| InChI | InChI=1S/C23H26N5S.BrH/c1-5-28(6-2)20-16-26(3)23(29-20)25-24-21-18-14-10-11-15-19(18)27(4)22(21)17-12-8-7-9-13-17;/h7-16H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | UKJJVKNOMNLWDD-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|