About (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide
(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide (PubChem CID 68837530) has the molecular formula C23H25BrN4S
and a molecular weight of 469.45 g/mol. Its IUPAC name is (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide.
Molecular Properties
| Compound Name | (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide |
| PubChem CID | 68837530 |
| Molecular Formula | C23H25BrN4S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide |
| SMILES | CCn1c(-c2ccccc2)c(/N=N/c2sc(C)c(C)[n+]2CC)c2ccccc21.[Br-] |
| InChI | InChI=1S/C23H25N4S.BrH/c1-5-26-16(3)17(4)28-23(26)25-24-21-19-14-10-11-15-20(19)27(6-2)22(21)18-12-8-7-9-13-18;/h7-15H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | JBKLGZSWRRFEHN-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide?
The IUPAC name of (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide (CID 68837530) is (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide.
What is the SMILES notation for (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide?
The canonical SMILES for (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide is CCn1c(-c2ccccc2)c(/N=N/c2sc(C)c(C)[n+]2CC)c2ccccc21.[Br-].
What is the InChIKey of (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide?
The InChIKey is JBKLGZSWRRFEHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H25N4S.BrH/c1-5-26-16(3)17(4)28-23(26)25-24-21-19-14-10-11-15-20(19)27(6-2)22(21)18-12-8-7-9-13-18;/h7-15H,5-6H2,1-4H3;1H/q+1;/p-1.
What are the key properties of (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide?
(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide has a molecular weight of 469.45 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(1-ethyl-2-phenylindol-3-yl)diazene bromide is sourced from PubChem (CID 68837530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).