C20H19ClN4S — CID 68837588
(1-ethyl-2-phenylindol-3-yl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene chloride (PubChem CID 68837588) has the molecular formula C20H19ClN4S and a molecular weight of 382.92 g/mol. Its IUPAC name is (1-ethyl-2-phenylindol-3-yl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene chloride.
| Compound Name | (1-ethyl-2-phenylindol-3-yl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene chloride |
|---|---|
| PubChem CID | 68837588 |
| Molecular Formula | C20H19ClN4S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (1-ethyl-2-phenylindol-3-yl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene chloride |
| SMILES | CCn1c(-c2ccccc2)c(/N=N/c2scc[n+]2C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C20H19N4S.ClH/c1-3-24-17-12-8-7-11-16(17)18(19(24)15-9-5-4-6-10-15)21-22-20-23(2)13-14-25-20;/h4-14H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XYYNFHBDLFEIOL-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|