C14H14ClN5O2S — CID 69224655
(1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-1,3-thiazol-3-ium-2-yl)diazene chloride (PubChem CID 69224655) has the molecular formula C14H14ClN5O2S and a molecular weight of 351.82 g/mol. Its IUPAC name is (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-1,3-thiazol-3-ium-2-yl)diazene chloride.
| Compound Name | (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-1,3-thiazol-3-ium-2-yl)diazene chloride |
|---|---|
| PubChem CID | 69224655 |
| Molecular Formula | C14H14ClN5O2S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (1,2-dimethylindol-3-yl)-(3-methyl-5-nitro-1,3-thiazol-3-ium-2-yl)diazene chloride |
| SMILES | Cc1c(/N=N/c2sc([N+](=O)[O-])c[n+]2C)c2ccccc2n1C.[Cl-] |
| InChI | InChI=1S/C14H14N5O2S.ClH/c1-9-13(10-6-4-5-7-11(10)18(9)3)15-16-14-17(2)8-12(22-14)19(20)21;/h4-8H,1-3H3;1H/q+1;/p-1 |
| InChIKey | YHFLEZGZSYAYNM-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|