C18H18N2O2 — CID 101420048
1,2-dimethyl-3-[2-(4-nitrophenyl)ethyl]indole (PubChem CID 101420048) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-(4-nitrophenyl)ethyl]indole.
| Compound Name | 1,2-dimethyl-3-[2-(4-nitrophenyl)ethyl]indole |
|---|---|
| PubChem CID | 101420048 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1,2-dimethyl-3-[2-(4-nitrophenyl)ethyl]indole |
| SMILES | Cc1c(CCc2ccc([N+](=O)[O-])cc2)c2ccccc2n1C |
| InChI | InChI=1S/C18H18N2O2/c1-13-16(17-5-3-4-6-18(17)19(13)2)12-9-14-7-10-15(11-8-14)20(21)22/h3-8,10-11H,9,12H2,1-2H3 |
| InChIKey | XUCATRKGGNWZOU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|