C28H24N3O2P — CID 4224465
(1,2-dimethylindol-3-yl)-(4-nitrophenyl)imino-diphenyl-λ5-phosphane (PubChem CID 4224465) has the molecular formula C28H24N3O2P and a molecular weight of 465.49 g/mol. Its IUPAC name is (1,2-dimethylindol-3-yl)-(4-nitrophenyl)imino-diphenyl-λ5-phosphane.
| Compound Name | (1,2-dimethylindol-3-yl)-(4-nitrophenyl)imino-diphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 4224465 |
| Molecular Formula | C28H24N3O2P |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (1,2-dimethylindol-3-yl)-(4-nitrophenyl)imino-diphenyl-λ5-phosphane |
| SMILES | Cc1c(P(=Nc2ccc([N+](=O)[O-])cc2)(c2ccccc2)c2ccccc2)c2ccccc2n1C |
| InChI | InChI=1S/C28H24N3O2P/c1-21-28(26-15-9-10-16-27(26)30(21)2)34(24-11-5-3-6-12-24,25-13-7-4-8-14-25)29-22-17-19-23(20-18-22)31(32)33/h3-20H,1-2H3 |
| InChIKey | IIGUXNXOBZBGTN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|