C15H14N6 — CID 20744713
5-[(1,2-dimethylindol-3-yl)diazenyl]-1-methylpyrazole-4-carbonitrile (PubChem CID 20744713) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is 5-[(1,2-dimethylindol-3-yl)diazenyl]-1-methylpyrazole-4-carbonitrile.
| Compound Name | 5-[(1,2-dimethylindol-3-yl)diazenyl]-1-methylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 20744713 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-[(1,2-dimethylindol-3-yl)diazenyl]-1-methylpyrazole-4-carbonitrile |
| SMILES | Cc1c(/N=N/c2c(C#N)cnn2C)c2ccccc2n1C |
| InChI | InChI=1S/C15H14N6/c1-10-14(12-6-4-5-7-13(12)20(10)2)18-19-15-11(8-16)9-17-21(15)3/h4-7,9H,1-3H3/b19-18+ |
| InChIKey | RDTINGQBJTYRRD-VHEBQXMUSA-N |
| XLogP | 3.51 |
| TPSA | 71.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|