C25H21BrN4S — CID 68831281
(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-(1,2-diphenylindol-3-yl)diazene bromide (PubChem CID 68831281) has the molecular formula C25H21BrN4S and a molecular weight of 489.44 g/mol. Its IUPAC name is (3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-(1,2-diphenylindol-3-yl)diazene bromide.
| Compound Name | (3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-(1,2-diphenylindol-3-yl)diazene bromide |
|---|---|
| PubChem CID | 68831281 |
| Molecular Formula | C25H21BrN4S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-(1,2-diphenylindol-3-yl)diazene bromide |
| SMILES | Cc1csc(/N=N/c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)[n+]1C.[Br-] |
| InChI | InChI=1S/C25H21N4S.BrH/c1-18-17-30-25(28(18)2)27-26-23-21-15-9-10-16-22(21)29(20-13-7-4-8-14-20)24(23)19-11-5-3-6-12-19;/h3-17H,1-2H3;1H/q+1;/p-1 |
| InChIKey | USZXEZXBGHMFRT-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|